C22H20ClN5O3S — CID 4135211
N-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide (PubChem CID 4135211) has the molecular formula C22H20ClN5O3S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 4135211 |
| Molecular Formula | C22H20ClN5O3S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(CSc2nc(C)cc(C)n2)cc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20ClN5O3S/c1-13-10-14(2)25-22(24-13)32-12-16-4-6-17(7-5-16)21(29)27-26-15(3)18-8-9-19(23)20(11-18)28(30)31/h4-11H,12H2,1-3H3,(H,27,29) |
| InChIKey | WWQVBLAEIUBBJZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|