C22H28N2OS — CID 7261508
(2S)-2-benzylsulfanyl-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]propanamide (PubChem CID 7261508) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is (2S)-2-benzylsulfanyl-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]propanamide.
| Compound Name | (2S)-2-benzylsulfanyl-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]propanamide |
|---|---|
| PubChem CID | 7261508 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (2S)-2-benzylsulfanyl-N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]propanamide |
| SMILES | C/C(=N/NC(=O)[C@H](C)SCc1ccccc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N2OS/c1-16(19-11-13-20(14-12-19)22(3,4)5)23-24-21(25)17(2)26-15-18-9-7-6-8-10-18/h6-14,17H,15H2,1-5H3,(H,24,25)/b23-16-/t17-/m0/s1 |
| InChIKey | GCVUXZXDAXCRCQ-HEQHKCQXSA-N |
| XLogP | 5.15 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|