C17H25N5O6 — CID 13417375
2-N,6-N-bis[3-[acetyl(hydroxy)amino]propyl]pyridine-2,6-dicarboxamide (PubChem CID 13417375) has the molecular formula C17H25N5O6 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-N,6-N-bis[3-[acetyl(hydroxy)amino]propyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[3-[acetyl(hydroxy)amino]propyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 13417375 |
| Molecular Formula | C17H25N5O6 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-N,6-N-bis[3-[acetyl(hydroxy)amino]propyl]pyridine-2,6-dicarboxamide |
| SMILES | CC(=O)N(O)CCCNC(=O)c1cccc(C(=O)NCCCN(O)C(C)=O)n1 |
| InChI | InChI=1S/C17H25N5O6/c1-12(23)21(27)10-4-8-18-16(25)14-6-3-7-15(20-14)17(26)19-9-5-11-22(28)13(2)24/h3,6-7,27-28H,4-5,8-11H2,1-2H3,(H,18,25)(H,19,26) |
| InChIKey | YZJPCSPULBYBTB-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|