C19H30N4O2 — CID 109096549
6-N-cycloheptyl-2-N-[3-(dimethylamino)propyl]pyridine-2,6-dicarboxamide (PubChem CID 109096549) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 6-N-cycloheptyl-2-N-[3-(dimethylamino)propyl]pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-cycloheptyl-2-N-[3-(dimethylamino)propyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109096549 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 6-N-cycloheptyl-2-N-[3-(dimethylamino)propyl]pyridine-2,6-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(C(=O)NC2CCCCCC2)n1 |
| InChI | InChI=1S/C19H30N4O2/c1-23(2)14-8-13-20-18(24)16-11-7-12-17(22-16)19(25)21-15-9-5-3-4-6-10-15/h7,11-12,15H,3-6,8-10,13-14H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | UOTQCYRLEYWUNV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|