C20H31N3O2 — CID 109099249
2-N-cycloheptyl-6-N,6-N-dipropylpyridine-2,6-dicarboxamide (PubChem CID 109099249) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-N-cycloheptyl-6-N,6-N-dipropylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-cycloheptyl-6-N,6-N-dipropylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109099249 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-N-cycloheptyl-6-N,6-N-dipropylpyridine-2,6-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)NC2CCCCCC2)n1 |
| InChI | InChI=1S/C20H31N3O2/c1-3-14-23(15-4-2)20(25)18-13-9-12-17(22-18)19(24)21-16-10-7-5-6-8-11-16/h9,12-13,16H,3-8,10-11,14-15H2,1-2H3,(H,21,24) |
| InChIKey | CKYNASFQBMHAPV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |