C20H28N4O2 — CID 109068204
1-N-cyclopentyl-3-N,3-N-dipropylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109068204) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-N-cyclopentyl-3-N,3-N-dipropylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-cyclopentyl-3-N,3-N-dipropylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109068204 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-N-cyclopentyl-3-N,3-N-dipropylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1nc(C(=O)NC2CCCC2)c2ccccn12 |
| InChI | InChI=1S/C20H28N4O2/c1-3-12-23(13-4-2)20(26)18-22-17(16-11-7-8-14-24(16)18)19(25)21-15-9-5-6-10-15/h7-8,11,14-15H,3-6,9-10,12-13H2,1-2H3,(H,21,25) |
| InChIKey | KGPCIAJAZNXUPL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |