C17H28N4O2 — CID 109096551
2-N-[3-(dimethylamino)propyl]-6-N-(3-methylbutyl)pyridine-2,6-dicarboxamide (PubChem CID 109096551) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-6-N-(3-methylbutyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-6-N-(3-methylbutyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109096551 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-6-N-(3-methylbutyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(C)CCNC(=O)c1cccc(C(=O)NCCCN(C)C)n1 |
| InChI | InChI=1S/C17H28N4O2/c1-13(2)9-11-19-17(23)15-8-5-7-14(20-15)16(22)18-10-6-12-21(3)4/h5,7-8,13H,6,9-12H2,1-4H3,(H,18,22)(H,19,23) |
| InChIKey | JZXCBELALYUQJP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|