C17H21F6N7S2 — CID 142539582
1-[(E)-[(1E)-1-[4-(dimethylamino)phenyl]-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 142539582) has the molecular formula C17H21F6N7S2 and a molecular weight of 501.53 g/mol. Its IUPAC name is 1-[(E)-[(1E)-1-[4-(dimethylamino)phenyl]-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[(E)-[(1E)-1-[4-(dimethylamino)phenyl]-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 142539582 |
| Molecular Formula | C17H21F6N7S2 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 1-[(E)-[(1E)-1-[4-(dimethylamino)phenyl]-1-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propan-2-ylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | CC(=N\NC(=S)NCC(F)(F)F)/C(=N/NC(=S)NCC(F)(F)F)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H21F6N7S2/c1-10(26-28-14(31)24-8-16(18,19)20)13(11-4-6-12(7-5-11)30(2)3)27-29-15(32)25-9-17(21,22)23/h4-7H,8-9H2,1-3H3,(H2,24,28,31)(H2,25,29,32)/b26-10+,27-13- |
| InChIKey | VVEIUNVVFMVCLI-KSMAYKRVSA-N |
| XLogP | 2.89 |
| TPSA | 76.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|