C23H30N6S2 — CID 13436345
1-[2,2-dimethyl-3-[[(E)-1-phenylethylideneamino]carbamothioylamino]propyl]-3-[(E)-1-phenylethylideneamino]thiourea (PubChem CID 13436345) has the molecular formula C23H30N6S2 and a molecular weight of 454.67 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-[[(E)-1-phenylethylideneamino]carbamothioylamino]propyl]-3-[(E)-1-phenylethylideneamino]thiourea.
| Compound Name | 1-[2,2-dimethyl-3-[[(E)-1-phenylethylideneamino]carbamothioylamino]propyl]-3-[(E)-1-phenylethylideneamino]thiourea |
|---|---|
| PubChem CID | 13436345 |
| Molecular Formula | C23H30N6S2 |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-[2,2-dimethyl-3-[[(E)-1-phenylethylideneamino]carbamothioylamino]propyl]-3-[(E)-1-phenylethylideneamino]thiourea |
| SMILES | C/C(=N\NC(=S)NCC(C)(C)CNC(=S)N/N=C(\C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N6S2/c1-17(19-11-7-5-8-12-19)26-28-21(30)24-15-23(3,4)16-25-22(31)29-27-18(2)20-13-9-6-10-14-20/h5-14H,15-16H2,1-4H3,(H2,24,28,30)(H2,25,29,31)/b26-17+,27-18+ |
| InChIKey | OXNSZWYQVOLXQQ-HEPXYTLMSA-N |
| XLogP | 3.79 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|