C11H13F3N4S — CID 86777006
1-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 86777006) has the molecular formula C11H13F3N4S and a molecular weight of 290.31 g/mol. Its IUPAC name is 1-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 86777006 |
| Molecular Formula | C11H13F3N4S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | C/C(=N/NC(=S)NCC(F)(F)F)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H13F3N4S/c1-7(8-2-4-9(15)5-3-8)17-18-10(19)16-6-11(12,13)14/h2-5H,6,15H2,1H3,(H2,16,18,19)/b17-7- |
| InChIKey | HFYFFSXPMGPJMH-IDUWFGFVSA-N |
| XLogP | 2.02 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|