C17H24N4O2 — CID 4925186
N-[2-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 4925186) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[2-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4925186 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-[2-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | CC(=NNC(=O)CNC(=O)C1CCCCC1)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H24N4O2/c1-12(13-7-9-15(18)10-8-13)20-21-16(22)11-19-17(23)14-5-3-2-4-6-14/h7-10,14H,2-6,11,18H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | WMYJZWFEESTOBV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|