C17H19ClN4O — CID 5427988
N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(3-chloro-2-methylanilino)acetamide (PubChem CID 5427988) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(3-chloro-2-methylanilino)acetamide.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(3-chloro-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 5427988 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-2-(3-chloro-2-methylanilino)acetamide |
| SMILES | C/C(=N\NC(=O)CNc1cccc(Cl)c1C)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H19ClN4O/c1-11-15(18)4-3-5-16(11)20-10-17(23)22-21-12(2)13-6-8-14(19)9-7-13/h3-9,20H,10,19H2,1-2H3,(H,22,23)/b21-12+ |
| InChIKey | KWKDVCKAEKNVGT-CIAFOILYSA-N |
| XLogP | 3.18 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|