C18H19ClN4O2 — CID 3419515
N'-[1-(4-aminophenyl)ethylideneamino]-N-(2-chlorophenyl)butanediamide (PubChem CID 3419515) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is N'-[1-(4-aminophenyl)ethylideneamino]-N-(2-chlorophenyl)butanediamide.
| Compound Name | N'-[1-(4-aminophenyl)ethylideneamino]-N-(2-chlorophenyl)butanediamide |
|---|---|
| PubChem CID | 3419515 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N'-[1-(4-aminophenyl)ethylideneamino]-N-(2-chlorophenyl)butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)Nc1ccccc1Cl)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H19ClN4O2/c1-12(13-6-8-14(20)9-7-13)22-23-18(25)11-10-17(24)21-16-5-3-2-4-15(16)19/h2-9H,10-11,20H2,1H3,(H,21,24)(H,23,25) |
| InChIKey | XKUZDLRUPWGIQP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|