C20H17F6N7O2S2 — CID 142539199
1-[(E)-[(2E)-1-(4-nitrophenyl)-2-phenyl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 142539199) has the molecular formula C20H17F6N7O2S2 and a molecular weight of 565.52 g/mol. Its IUPAC name is 1-[(E)-[(2E)-1-(4-nitrophenyl)-2-phenyl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[(E)-[(2E)-1-(4-nitrophenyl)-2-phenyl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 142539199 |
| Molecular Formula | C20H17F6N7O2S2 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 1-[(E)-[(2E)-1-(4-nitrophenyl)-2-phenyl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(C(=N\NC(=S)NCC(F)(F)F)/C(=N/NC(=S)NCC(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17F6N7O2S2/c21-19(22,23)10-27-17(36)31-29-15(12-4-2-1-3-5-12)16(13-6-8-14(9-7-13)33(34)35)30-32-18(37)28-11-20(24,25)26/h1-9H,10-11H2,(H2,27,31,36)(H2,28,32,37)/b29-15+,30-16+ |
| InChIKey | SGCWLOKKQPNSFK-CMNXJCJSSA-N |
| XLogP | 3.76 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|