About bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium
bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium (PubChem CID 50912150) has the molecular formula C20H24N4PdS4
and a molecular weight of 555.13 g/mol. Its IUPAC name is bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium.
Molecular Properties
| Compound Name | bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium |
| PubChem CID | 50912150 |
| Molecular Formula | C20H24N4PdS4 |
| Molecular Weight | 555.13 g/mol |
| Exact Mass | 553.99 |
| IUPAC Name | bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium |
| SMILES | CSC(=S)NN=C(C)c1ccccc1.CSC(=S)NN=C(C)c1ccccc1.[Pd] |
| InChI | InChI=1S/2C10H12N2S2.Pd/c2*1-8(11-12-10(13)14-2)9-6-4-3-5-7-9;/h2*3-7H,1-2H3,(H,12,13); |
| InChIKey | QCJMNVRVDLLZNT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.13 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium?
The IUPAC name of bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium (CID 50912150) is bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium.
What is the SMILES notation for bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium?
The canonical SMILES for bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium is CSC(=S)NN=C(C)c1ccccc1.CSC(=S)NN=C(C)c1ccccc1.[Pd].
What is the InChIKey of bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium?
The InChIKey is QCJMNVRVDLLZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H12N2S2.Pd/c2*1-8(11-12-10(13)14-2)9-6-4-3-5-7-9;/h2*3-7H,1-2H3,(H,12,13);.
What are the key properties of bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium?
bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium has a molecular weight of 555.13 g/mol, XLogP of 5.29, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methyl N-(1-phenylethylideneamino)carbamodithioate);palladium is sourced from PubChem (CID 50912150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).