C25H26N6 — CID 5226187
1,2,3-tris(1-phenylethylideneamino)guanidine (PubChem CID 5226187) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 1,2,3-tris(1-phenylethylideneamino)guanidine.
| Compound Name | 1,2,3-tris(1-phenylethylideneamino)guanidine |
|---|---|
| PubChem CID | 5226187 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1,2,3-tris(1-phenylethylideneamino)guanidine |
| SMILES | CC(=NN=C(NN=C(C)c1ccccc1)NN=C(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N6/c1-19(22-13-7-4-8-14-22)26-29-25(30-27-20(2)23-15-9-5-10-16-23)31-28-21(3)24-17-11-6-12-18-24/h4-18H,1-3H3,(H2,29,30,31) |
| InChIKey | RXBDFPMHYLTZDJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|