C8H11N3S2 — CID 4284798
methyl N-[1-(1H-pyrrol-2-yl)ethylideneamino]carbamodithioate (PubChem CID 4284798) has the molecular formula C8H11N3S2 and a molecular weight of 213.33 g/mol. Its IUPAC name is methyl N-[1-(1H-pyrrol-2-yl)ethylideneamino]carbamodithioate.
| Compound Name | methyl N-[1-(1H-pyrrol-2-yl)ethylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 4284798 |
| Molecular Formula | C8H11N3S2 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | methyl N-[1-(1H-pyrrol-2-yl)ethylideneamino]carbamodithioate |
| SMILES | CSC(=S)NN=C(C)c1ccc[nH]1 |
| InChI | InChI=1S/C8H11N3S2/c1-6(7-4-3-5-9-7)10-11-8(12)13-2/h3-5,9H,1-2H3,(H,11,12) |
| InChIKey | CFBDUNSNXPXLAT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|