C12H14N4OS — CID 162738403
2,4-dimethyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 162738403) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 162738403 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2,4-dimethyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | C/C(=N\NC(=O)c1sc(C)nc1C)c1ccc[nH]1 |
| InChI | InChI=1S/C12H14N4OS/c1-7(10-5-4-6-13-10)15-16-12(17)11-8(2)14-9(3)18-11/h4-6,13H,1-3H3,(H,16,17)/b15-7+ |
| InChIKey | IRRONIOGIHUTOX-VIZOYTHASA-N |
| XLogP | 2.24 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|