About cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate)
cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) (PubChem CID 50910839) has the molecular formula C30H28CoN4S4
and a molecular weight of 631.78 g/mol. Its IUPAC name is cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate).
Molecular Properties
| Compound Name | cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) |
| PubChem CID | 50910839 |
| Molecular Formula | C30H28CoN4S4 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.05 |
| IUPAC Name | cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) |
| SMILES | CSC(=S)NN=C(c1ccccc1)c1ccccc1.CSC(=S)NN=C(c1ccccc1)c1ccccc1.[Co] |
| InChI | InChI=1S/2C15H14N2S2.Co/c2*1-19-15(18)17-16-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2*2-11H,1H3,(H,17,18); |
| InChIKey | KXNLASOXSSZQPW-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate)?
The IUPAC name of cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) (CID 50910839) is cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate).
What is the SMILES notation for cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate)?
The canonical SMILES for cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) is CSC(=S)NN=C(c1ccccc1)c1ccccc1.CSC(=S)NN=C(c1ccccc1)c1ccccc1.[Co].
What is the InChIKey of cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate)?
The InChIKey is KXNLASOXSSZQPW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H14N2S2.Co/c2*1-19-15(18)17-16-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2*2-11H,1H3,(H,17,18);.
What are the key properties of cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate)?
cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) has a molecular weight of 631.78 g/mol, XLogP of 7.35, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(methyl N-(benzhydrylideneamino)carbamodithioate) is sourced from PubChem (CID 50910839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).