About ethane;methyl benzenecarbodithioate
ethane;methyl benzenecarbodithioate (PubChem CID 144606812) has the molecular formula C12H20S2
and a molecular weight of 228.43 g/mol. Its IUPAC name is ethane;methyl benzenecarbodithioate.
Molecular Properties
| Compound Name | ethane;methyl benzenecarbodithioate |
| PubChem CID | 144606812 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | ethane;methyl benzenecarbodithioate |
| SMILES | CC.CC.CSC(=S)c1ccccc1 |
| InChI | InChI=1S/C8H8S2.2C2H6/c1-10-8(9)7-5-3-2-4-6-7;2*1-2/h2-6H,1H3;2*1-2H3 |
| InChIKey | WHUOYTMBJBJGIK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl benzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl benzenecarbodithioate?
The IUPAC name of ethane;methyl benzenecarbodithioate (CID 144606812) is ethane;methyl benzenecarbodithioate.
What is the SMILES notation for ethane;methyl benzenecarbodithioate?
The canonical SMILES for ethane;methyl benzenecarbodithioate is CC.CC.CSC(=S)c1ccccc1.
What is the InChIKey of ethane;methyl benzenecarbodithioate?
The InChIKey is WHUOYTMBJBJGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S2.2C2H6/c1-10-8(9)7-5-3-2-4-6-7;2*1-2/h2-6H,1H3;2*1-2H3.
What are the key properties of ethane;methyl benzenecarbodithioate?
ethane;methyl benzenecarbodithioate has a molecular weight of 228.43 g/mol, XLogP of 4.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl benzenecarbodithioate is sourced from PubChem (CID 144606812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).