About 1-cyanoethyl benzenecarbodithioate
1-cyanoethyl benzenecarbodithioate (PubChem CID 59751186) has the molecular formula C10H9NS2
and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-cyanoethyl benzenecarbodithioate.
Molecular Properties
| Compound Name | 1-cyanoethyl benzenecarbodithioate |
| PubChem CID | 59751186 |
| Molecular Formula | C10H9NS2 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 1-cyanoethyl benzenecarbodithioate |
| SMILES | CC(C#N)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C10H9NS2/c1-8(7-11)13-10(12)9-5-3-2-4-6-9/h2-6,8H,1H3 |
| InChIKey | OIGDIJLRDXGABB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoethyl benzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethyl benzenecarbodithioate?
The IUPAC name of 1-cyanoethyl benzenecarbodithioate (CID 59751186) is 1-cyanoethyl benzenecarbodithioate.
What is the SMILES notation for 1-cyanoethyl benzenecarbodithioate?
The canonical SMILES for 1-cyanoethyl benzenecarbodithioate is CC(C#N)SC(=S)c1ccccc1.
What is the InChIKey of 1-cyanoethyl benzenecarbodithioate?
The InChIKey is OIGDIJLRDXGABB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS2/c1-8(7-11)13-10(12)9-5-3-2-4-6-9/h2-6,8H,1H3.
What are the key properties of 1-cyanoethyl benzenecarbodithioate?
1-cyanoethyl benzenecarbodithioate has a molecular weight of 207.32 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethyl benzenecarbodithioate is sourced from PubChem (CID 59751186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).