About 2-phenylethyl benzenecarbodithioate
2-phenylethyl benzenecarbodithioate (PubChem CID 23390622) has the molecular formula C15H14S2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-phenylethyl benzenecarbodithioate.
Molecular Properties
| Compound Name | 2-phenylethyl benzenecarbodithioate |
| PubChem CID | 23390622 |
| Molecular Formula | C15H14S2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-phenylethyl benzenecarbodithioate |
| SMILES | S=C(SCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14S2/c16-15(14-9-5-2-6-10-14)17-12-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | JXPLECNKPVHWMG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl benzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl benzenecarbodithioate?
The IUPAC name of 2-phenylethyl benzenecarbodithioate (CID 23390622) is 2-phenylethyl benzenecarbodithioate.
What is the SMILES notation for 2-phenylethyl benzenecarbodithioate?
The canonical SMILES for 2-phenylethyl benzenecarbodithioate is S=C(SCCc1ccccc1)c1ccccc1.
What is the InChIKey of 2-phenylethyl benzenecarbodithioate?
The InChIKey is JXPLECNKPVHWMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14S2/c16-15(14-9-5-2-6-10-14)17-12-11-13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of 2-phenylethyl benzenecarbodithioate?
2-phenylethyl benzenecarbodithioate has a molecular weight of 258.41 g/mol, XLogP of 4.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl benzenecarbodithioate is sourced from PubChem (CID 23390622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).