C38H30S8 — CID 54560307
[2,3,4-tris(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate (PubChem CID 54560307) has the molecular formula C38H30S8 and a molecular weight of 743.19 g/mol. Its IUPAC name is [2,3,4-tris(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate.
| Compound Name | [2,3,4-tris(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate |
|---|---|
| PubChem CID | 54560307 |
| Molecular Formula | C38H30S8 |
| Molecular Weight | 743.19 g/mol |
| Exact Mass | 742.01 |
| IUPAC Name | [2,3,4-tris(benzenecarbonothioylsulfanylmethyl)phenyl]methyl benzenecarbodithioate |
| SMILES | S=C(SCc1ccc(CSC(=S)c2ccccc2)c(CSC(=S)c2ccccc2)c1CSC(=S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H30S8/c39-35(27-13-5-1-6-14-27)43-23-31-21-22-32(24-44-36(40)28-15-7-2-8-16-28)34(26-46-38(42)30-19-11-4-12-20-30)33(31)25-45-37(41)29-17-9-3-10-18-29/h1-22H,23-26H2 |
| InChIKey | ZQBSNYXBXMADTQ-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.19 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|