About (4-cyanophenyl)methyl benzenecarbodithioate
(4-cyanophenyl)methyl benzenecarbodithioate (PubChem CID 101118786) has the molecular formula C15H11NS2
and a molecular weight of 269.39 g/mol. Its IUPAC name is (4-cyanophenyl)methyl benzenecarbodithioate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl benzenecarbodithioate |
| PubChem CID | 101118786 |
| Molecular Formula | C15H11NS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (4-cyanophenyl)methyl benzenecarbodithioate |
| SMILES | N#Cc1ccc(CSC(=S)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11NS2/c16-10-12-6-8-13(9-7-12)11-18-15(17)14-4-2-1-3-5-14/h1-9H,11H2 |
| InChIKey | DJCFOJCHNVZQIG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl)methyl benzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl benzenecarbodithioate?
The IUPAC name of (4-cyanophenyl)methyl benzenecarbodithioate (CID 101118786) is (4-cyanophenyl)methyl benzenecarbodithioate.
What is the SMILES notation for (4-cyanophenyl)methyl benzenecarbodithioate?
The canonical SMILES for (4-cyanophenyl)methyl benzenecarbodithioate is N#Cc1ccc(CSC(=S)c2ccccc2)cc1.
What is the InChIKey of (4-cyanophenyl)methyl benzenecarbodithioate?
The InChIKey is DJCFOJCHNVZQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NS2/c16-10-12-6-8-13(9-7-12)11-18-15(17)14-4-2-1-3-5-14/h1-9H,11H2.
What are the key properties of (4-cyanophenyl)methyl benzenecarbodithioate?
(4-cyanophenyl)methyl benzenecarbodithioate has a molecular weight of 269.39 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl benzenecarbodithioate is sourced from PubChem (CID 101118786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).