C23H18N2S — CID 101039685
N-[(4-cyanophenyl)methyl]-N,2-diphenylprop-2-enethioamide (PubChem CID 101039685) has the molecular formula C23H18N2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N,2-diphenylprop-2-enethioamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-N,2-diphenylprop-2-enethioamide |
|---|---|
| PubChem CID | 101039685 |
| Molecular Formula | C23H18N2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N,2-diphenylprop-2-enethioamide |
| SMILES | C=C(C(=S)N(Cc1ccc(C#N)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18N2S/c1-18(21-8-4-2-5-9-21)23(26)25(22-10-6-3-7-11-22)17-20-14-12-19(16-24)13-15-20/h2-15H,1,17H2 |
| InChIKey | FKGARUSMKOGVER-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|