About [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate
[(Z)-2-chlorobut-2-enyl] benzenecarbodithioate (PubChem CID 146314677) has the molecular formula C11H11ClS2
and a molecular weight of 242.80 g/mol. Its IUPAC name is [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate.
Molecular Properties
| Compound Name | [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate |
| PubChem CID | 146314677 |
| Molecular Formula | C11H11ClS2 |
| Molecular Weight | 242.80 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate |
| SMILES | C/C=C(\Cl)CSC(=S)c1ccccc1 |
| InChI | InChI=1S/C11H11ClS2/c1-2-10(12)8-14-11(13)9-6-4-3-5-7-9/h2-7H,8H2,1H3/b10-2- |
| InChIKey | LGOBPNKRUBNBGK-SGAXSIHGSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.80 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate?
The IUPAC name of [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate (CID 146314677) is [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate.
What is the SMILES notation for [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate?
The canonical SMILES for [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate is C/C=C(\Cl)CSC(=S)c1ccccc1.
What is the InChIKey of [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate?
The InChIKey is LGOBPNKRUBNBGK-SGAXSIHGSA-N. The full InChI is InChI=1S/C11H11ClS2/c1-2-10(12)8-14-11(13)9-6-4-3-5-7-9/h2-7H,8H2,1H3/b10-2-.
What are the key properties of [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate?
[(Z)-2-chlorobut-2-enyl] benzenecarbodithioate has a molecular weight of 242.80 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-chlorobut-2-enyl] benzenecarbodithioate is sourced from PubChem (CID 146314677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).