C12H15NOS2 — CID 87669715
(3-amino-2,2-dimethyl-3-oxopropyl) benzenecarbodithioate (PubChem CID 87669715) has the molecular formula C12H15NOS2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (3-amino-2,2-dimethyl-3-oxopropyl) benzenecarbodithioate.
| Compound Name | (3-amino-2,2-dimethyl-3-oxopropyl) benzenecarbodithioate |
|---|---|
| PubChem CID | 87669715 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (3-amino-2,2-dimethyl-3-oxopropyl) benzenecarbodithioate |
| SMILES | CC(C)(CSC(=S)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C12H15NOS2/c1-12(2,11(13)14)8-16-10(15)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H2,13,14) |
| InChIKey | QJBYKYNRBGMVPU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|