C18H18OS2 — CID 155346739
(4-acetyl-3,5-dimethylphenyl)methyl benzenecarbodithioate (PubChem CID 155346739) has the molecular formula C18H18OS2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4-acetyl-3,5-dimethylphenyl)methyl benzenecarbodithioate.
| Compound Name | (4-acetyl-3,5-dimethylphenyl)methyl benzenecarbodithioate |
|---|---|
| PubChem CID | 155346739 |
| Molecular Formula | C18H18OS2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (4-acetyl-3,5-dimethylphenyl)methyl benzenecarbodithioate |
| SMILES | CC(=O)c1c(C)cc(CSC(=S)c2ccccc2)cc1C |
| InChI | InChI=1S/C18H18OS2/c1-12-9-15(10-13(2)17(12)14(3)19)11-21-18(20)16-7-5-4-6-8-16/h4-10H,11H2,1-3H3 |
| InChIKey | PJZBQJCDLVADPM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|