About 2,3,3-trimethylbutan-2-yl benzenecarbodithioate
2,3,3-trimethylbutan-2-yl benzenecarbodithioate (PubChem CID 59257508) has the molecular formula C14H20S2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 2,3,3-trimethylbutan-2-yl benzenecarbodithioate.
Molecular Properties
| Compound Name | 2,3,3-trimethylbutan-2-yl benzenecarbodithioate |
| PubChem CID | 59257508 |
| Molecular Formula | C14H20S2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2,3,3-trimethylbutan-2-yl benzenecarbodithioate |
| SMILES | CC(C)(C)C(C)(C)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C14H20S2/c1-13(2,3)14(4,5)16-12(15)11-9-7-6-8-10-11/h6-10H,1-5H3 |
| InChIKey | ZBASBTFUUUTFAO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3,3-trimethylbutan-2-yl benzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3-trimethylbutan-2-yl benzenecarbodithioate?
The IUPAC name of 2,3,3-trimethylbutan-2-yl benzenecarbodithioate (CID 59257508) is 2,3,3-trimethylbutan-2-yl benzenecarbodithioate.
What is the SMILES notation for 2,3,3-trimethylbutan-2-yl benzenecarbodithioate?
The canonical SMILES for 2,3,3-trimethylbutan-2-yl benzenecarbodithioate is CC(C)(C)C(C)(C)SC(=S)c1ccccc1.
What is the InChIKey of 2,3,3-trimethylbutan-2-yl benzenecarbodithioate?
The InChIKey is ZBASBTFUUUTFAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20S2/c1-13(2,3)14(4,5)16-12(15)11-9-7-6-8-10-11/h6-10H,1-5H3.
What are the key properties of 2,3,3-trimethylbutan-2-yl benzenecarbodithioate?
2,3,3-trimethylbutan-2-yl benzenecarbodithioate has a molecular weight of 252.45 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-trimethylbutan-2-yl benzenecarbodithioate is sourced from PubChem (CID 59257508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).