C16H23NO2S2 — CID 144844918
2-cyanopentan-2-yl benzenecarbodithioate;ethane;formic acid (PubChem CID 144844918) has the molecular formula C16H23NO2S2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-cyanopentan-2-yl benzenecarbodithioate;ethane;formic acid.
| Compound Name | 2-cyanopentan-2-yl benzenecarbodithioate;ethane;formic acid |
|---|---|
| PubChem CID | 144844918 |
| Molecular Formula | C16H23NO2S2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-cyanopentan-2-yl benzenecarbodithioate;ethane;formic acid |
| SMILES | CC.CCCC(C)(C#N)SC(=S)c1ccccc1.O=CO |
| InChI | InChI=1S/C13H15NS2.C2H6.CH2O2/c1-3-9-13(2,10-14)16-12(15)11-7-5-4-6-8-11;1-2;2-1-3/h4-8H,3,9H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | VXIASZWGVXWWIW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|