C17H21NS2 — CID 143271106
(2,5-dimethyl-1-methyliminohepta-5,6-dien-2-yl) benzenecarbodithioate (PubChem CID 143271106) has the molecular formula C17H21NS2 and a molecular weight of 303.50 g/mol. Its IUPAC name is (2,5-dimethyl-1-methyliminohepta-5,6-dien-2-yl) benzenecarbodithioate.
| Compound Name | (2,5-dimethyl-1-methyliminohepta-5,6-dien-2-yl) benzenecarbodithioate |
|---|---|
| PubChem CID | 143271106 |
| Molecular Formula | C17H21NS2 |
| Molecular Weight | 303.50 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2,5-dimethyl-1-methyliminohepta-5,6-dien-2-yl) benzenecarbodithioate |
| SMILES | C=C=C(C)CCC(C)(/C=N/C)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C17H21NS2/c1-5-14(2)11-12-17(3,13-18-4)20-16(19)15-9-7-6-8-10-15/h6-10,13H,1,11-12H2,2-4H3/b18-13+ |
| InChIKey | KEICLWISJYEWTG-QGOAFFKASA-N |
| XLogP | 5.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|