C13H13NO2S2 — CID 177090643
[3-(benzenecarbonothioylsulfanyl)-3-cyanobutyl] formate (PubChem CID 177090643) has the molecular formula C13H13NO2S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is [3-(benzenecarbonothioylsulfanyl)-3-cyanobutyl] formate.
| Compound Name | [3-(benzenecarbonothioylsulfanyl)-3-cyanobutyl] formate |
|---|---|
| PubChem CID | 177090643 |
| Molecular Formula | C13H13NO2S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | [3-(benzenecarbonothioylsulfanyl)-3-cyanobutyl] formate |
| SMILES | CC(C#N)(CCOC=O)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C13H13NO2S2/c1-13(9-14,7-8-16-10-15)18-12(17)11-5-3-2-4-6-11/h2-6,10H,7-8H2,1H3 |
| InChIKey | UARHBOIBXUTHFI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|