About [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate
[2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate (PubChem CID 132534581) has the molecular formula C17H20N2OS3
and a molecular weight of 364.56 g/mol. Its IUPAC name is [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate.
Molecular Properties
| Compound Name | [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate |
| PubChem CID | 132534581 |
| Molecular Formula | C17H20N2OS3 |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate |
| SMILES | CC(C#N)(CCCNC1CCSC1=O)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C17H20N2OS3/c1-17(12-18,23-16(21)13-6-3-2-4-7-13)9-5-10-19-14-8-11-22-15(14)20/h2-4,6-7,14,19H,5,8-11H2,1H3 |
| InChIKey | OSVZUJFCMWSGFO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate?
The IUPAC name of [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate (CID 132534581) is [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate.
What is the SMILES notation for [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate?
The canonical SMILES for [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate is CC(C#N)(CCCNC1CCSC1=O)SC(=S)c1ccccc1.
What is the InChIKey of [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate?
The InChIKey is OSVZUJFCMWSGFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2OS3/c1-17(12-18,23-16(21)13-6-3-2-4-7-13)9-5-10-19-14-8-11-22-15(14)20/h2-4,6-7,14,19H,5,8-11H2,1H3.
What are the key properties of [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate?
[2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate has a molecular weight of 364.56 g/mol, XLogP of 3.78, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-5-[(2-oxothiolan-3-yl)amino]pentan-2-yl] benzenecarbodithioate is sourced from PubChem (CID 132534581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).