C23H21NO3S2 — CID 132522200
[4-(3-cyano-3-methyl-1-phenylbutyl)-2,5-dioxooxolan-3-yl] benzenecarbodithioate (PubChem CID 132522200) has the molecular formula C23H21NO3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is [4-(3-cyano-3-methyl-1-phenylbutyl)-2,5-dioxooxolan-3-yl] benzenecarbodithioate.
| Compound Name | [4-(3-cyano-3-methyl-1-phenylbutyl)-2,5-dioxooxolan-3-yl] benzenecarbodithioate |
|---|---|
| PubChem CID | 132522200 |
| Molecular Formula | C23H21NO3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [4-(3-cyano-3-methyl-1-phenylbutyl)-2,5-dioxooxolan-3-yl] benzenecarbodithioate |
| SMILES | CC(C)(C#N)CC(c1ccccc1)C1C(=O)OC(=O)C1SC(=S)c1ccccc1 |
| InChI | InChI=1S/C23H21NO3S2/c1-23(2,14-24)13-17(15-9-5-3-6-10-15)18-19(21(26)27-20(18)25)29-22(28)16-11-7-4-8-12-16/h3-12,17-19H,13H2,1-2H3 |
| InChIKey | NMTWJICYYZDEAA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|