C16H22N2O — CID 163446116
N-(4-cyano-2,4-dimethylpentyl)-N-phenylacetamide (PubChem CID 163446116) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(4-cyano-2,4-dimethylpentyl)-N-phenylacetamide.
| Compound Name | N-(4-cyano-2,4-dimethylpentyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 163446116 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-(4-cyano-2,4-dimethylpentyl)-N-phenylacetamide |
| SMILES | CC(=O)N(CC(C)CC(C)(C)C#N)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c1-13(10-16(3,4)12-17)11-18(14(2)19)15-8-6-5-7-9-15/h5-9,13H,10-11H2,1-4H3 |
| InChIKey | BCRAGIBJCWLGNX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |