C16H19F6NO — CID 90927173
ethene;3,3,3-trifluoro-N-(2-methylpropyl)-N-phenyl-2-(trifluoromethyl)propanamide (PubChem CID 90927173) has the molecular formula C16H19F6NO and a molecular weight of 355.32 g/mol. Its IUPAC name is ethene;3,3,3-trifluoro-N-(2-methylpropyl)-N-phenyl-2-(trifluoromethyl)propanamide.
| Compound Name | ethene;3,3,3-trifluoro-N-(2-methylpropyl)-N-phenyl-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 90927173 |
| Molecular Formula | C16H19F6NO |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | ethene;3,3,3-trifluoro-N-(2-methylpropyl)-N-phenyl-2-(trifluoromethyl)propanamide |
| SMILES | C=C.CC(C)CN(C(=O)C(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H15F6NO.C2H4/c1-9(2)8-21(10-6-4-3-5-7-10)12(22)11(13(15,16)17)14(18,19)20;1-2/h3-7,9,11H,8H2,1-2H3;1-2H2 |
| InChIKey | UYWHJSMHVJXAEA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|