C12H17NO2Y — CID 161236037
(4-methylphenyl)-(2-methylpropyl)carbamic acid;yttrium (PubChem CID 161236037) has the molecular formula C12H17NO2Y and a molecular weight of 296.18 g/mol. Its IUPAC name is (4-methylphenyl)-(2-methylpropyl)carbamic acid;yttrium.
| Compound Name | (4-methylphenyl)-(2-methylpropyl)carbamic acid;yttrium |
|---|---|
| PubChem CID | 161236037 |
| Molecular Formula | C12H17NO2Y |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | (4-methylphenyl)-(2-methylpropyl)carbamic acid;yttrium |
| SMILES | Cc1ccc(N(CC(C)C)C(=O)O)cc1.[Y] |
| InChI | InChI=1S/C12H17NO2.Y/c1-9(2)8-13(12(14)15)11-6-4-10(3)5-7-11;/h4-7,9H,8H2,1-3H3,(H,14,15); |
| InChIKey | RCFJDMNLIZMQPK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |