2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid

C12H17NO4 — CID 154106281

IUPAC2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid
SMILESCOC(CN(C(=O)O)c1ccc(C)cc1)OC
InChIInChI=1S/C12H17NO4/c1-9-4-6-10(7-5-9)13(12(14)15)8-11(16-2)17-3/h4-7,11H,8H2,1-3H3,(H,14,15)
InChIKeyMICAYBZEKACXBX-UHFFFAOYSA-N
MW239.27 g/mol
LogP2.10
Rot. Bonds5

About 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid

2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid (PubChem CID 154106281) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid.

Molecular Properties

Compound Name2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid
PubChem CID154106281
Molecular FormulaC12H17NO4
Molecular Weight239.27 g/mol
Exact Mass239.12
IUPAC Name2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid
SMILESCOC(CN(C(=O)O)c1ccc(C)cc1)OC
InChIInChI=1S/C12H17NO4/c1-9-4-6-10(7-5-9)13(12(14)15)8-11(16-2)17-3/h4-7,11H,8H2,1-3H3,(H,14,15)
InChIKeyMICAYBZEKACXBX-UHFFFAOYSA-N
XLogP2.10
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 52.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(4-methylphenyl)-(2-methylpropyl)carbamic acid;yttrium
CID 161236037
(4-methylphenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]carbamic acid
CID 150356013
2-[4-methyl-N-(4-methylpentanoyl)anilino]acetic acid
CID 60830764
2-(N-(2,2-difluoroacetyl)-4-methylanilino)acetic acid
CID 103513169
N-ethyl-2-methyl-N-(4-methylphenyl)propanamide
CID 60737044
N-(4-methylphenyl)-N-[(4-methylphenyl)methyl]propanamide
CID 139238463
[(2S)-3-hydroxy-2-methylpropyl]-phenylcarbamic acid
CID 54211065
ethane;N-ethyl-N-(4-methylphenyl)acetamide
CID 143607666
3-(N-[2-hydroxypropyl(methyl)carbamoyl]-4-methylanilino)propanoic acid
CID 62338364
3-(4-methyl-N-(2-propan-2-yloxyacetyl)anilino)propanoic acid
CID 115949224
3-(N-(2-methoxy-2-methylpropanoyl)-4-methylanilino)propanoic acid
CID 103018278
3-(4-methyl-N-[methyl(2-methylpropyl)carbamoyl]anilino)propanoic acid
CID 61196438

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid?
The IUPAC name of 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid (CID 154106281) is 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid.
What is the SMILES notation for 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid?
The canonical SMILES for 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid is COC(CN(C(=O)O)c1ccc(C)cc1)OC.
What is the InChIKey of 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid?
The InChIKey is MICAYBZEKACXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-9-4-6-10(7-5-9)13(12(14)15)8-11(16-2)17-3/h4-7,11H,8H2,1-3H3,(H,14,15).
What are the key properties of 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid?
2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid has a molecular weight of 239.27 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethyl-(4-methylphenyl)carbamic acid is sourced from PubChem (CID 154106281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).