C15H10F5NO2 — CID 150356013
(4-methylphenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]carbamic acid (PubChem CID 150356013) has the molecular formula C15H10F5NO2 and a molecular weight of 331.24 g/mol. Its IUPAC name is (4-methylphenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]carbamic acid.
| Compound Name | (4-methylphenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 150356013 |
| Molecular Formula | C15H10F5NO2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (4-methylphenyl)-[(2,3,4,5,6-pentafluorophenyl)methyl]carbamic acid |
| SMILES | Cc1ccc(N(Cc2c(F)c(F)c(F)c(F)c2F)C(=O)O)cc1 |
| InChI | InChI=1S/C15H10F5NO2/c1-7-2-4-8(5-3-7)21(15(22)23)6-9-10(16)12(18)14(20)13(19)11(9)17/h2-5H,6H2,1H3,(H,22,23) |
| InChIKey | GUSPKRHFCMESMZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|