C21H33N — CID 144663906
ethane;4-methyl-N-(2-methylpropyl)-N-phenylaniline (PubChem CID 144663906) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is ethane;4-methyl-N-(2-methylpropyl)-N-phenylaniline.
| Compound Name | ethane;4-methyl-N-(2-methylpropyl)-N-phenylaniline |
|---|---|
| PubChem CID | 144663906 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | ethane;4-methyl-N-(2-methylpropyl)-N-phenylaniline |
| SMILES | CC.CC.Cc1ccc(N(CC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N.2C2H6/c1-14(2)13-18(16-7-5-4-6-8-16)17-11-9-15(3)10-12-17;2*1-2/h4-12,14H,13H2,1-3H3;2*1-2H3 |
| InChIKey | DDKKGRCZXTULEZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |