C30H32N2 — CID 118073970
N,N,N',N'-tetrakis(4-methylphenyl)ethane-1,2-diamine (PubChem CID 118073970) has the molecular formula C30H32N2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(4-methylphenyl)ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis(4-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 118073970 |
| Molecular Formula | C30H32N2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N,N,N',N'-tetrakis(4-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(N(CCN(c2ccc(C)cc2)c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H32N2/c1-23-5-13-27(14-6-23)31(28-15-7-24(2)8-16-28)21-22-32(29-17-9-25(3)10-18-29)30-19-11-26(4)12-20-30/h5-20H,21-22H2,1-4H3 |
| InChIKey | RYYUEYSJNVEHIC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |