C32H40N2 — CID 146589451
N'-[(3Z,5Z)-5-methylocta-3,5-dien-2-yl]-N,N,N'-tris(4-methylphenyl)ethane-1,2-diamine (PubChem CID 146589451) has the molecular formula C32H40N2 and a molecular weight of 452.69 g/mol. Its IUPAC name is N'-[(3Z,5Z)-5-methylocta-3,5-dien-2-yl]-N,N,N'-tris(4-methylphenyl)ethane-1,2-diamine.
| Compound Name | N'-[(3Z,5Z)-5-methylocta-3,5-dien-2-yl]-N,N,N'-tris(4-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 146589451 |
| Molecular Formula | C32H40N2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | N'-[(3Z,5Z)-5-methylocta-3,5-dien-2-yl]-N,N,N'-tris(4-methylphenyl)ethane-1,2-diamine |
| SMILES | CC/C=C(C)\C=C/C(C)N(CCN(c1ccc(C)cc1)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H40N2/c1-7-8-25(2)9-16-29(6)33(30-17-10-26(3)11-18-30)23-24-34(31-19-12-27(4)13-20-31)32-21-14-28(5)15-22-32/h8-22,29H,7,23-24H2,1-6H3/b16-9-,25-8- |
| InChIKey | QFMUJWDPWIRCSL-LCFCYGPASA-N |
| XLogP | 8.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|