C16H22 — CID 170701365
1-methyl-4-[(3Z,5Z)-5-methylocta-3,5-dienyl]benzene (PubChem CID 170701365) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-methyl-4-[(3Z,5Z)-5-methylocta-3,5-dienyl]benzene.
| Compound Name | 1-methyl-4-[(3Z,5Z)-5-methylocta-3,5-dienyl]benzene |
|---|---|
| PubChem CID | 170701365 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-methyl-4-[(3Z,5Z)-5-methylocta-3,5-dienyl]benzene |
| SMILES | CC/C=C(C)\C=C/CCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H22/c1-4-7-14(2)8-5-6-9-16-12-10-15(3)11-13-16/h5,7-8,10-13H,4,6,9H2,1-3H3/b8-5-,14-7- |
| InChIKey | DLPXVVJFRCJQCE-ADNURMQWSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|