C17H24 — CID 163775080
4-ethenylidene-1-[(3E,5Z)-5-methylocta-3,5-dienyl]cyclohexene (PubChem CID 163775080) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 4-ethenylidene-1-[(3E,5Z)-5-methylocta-3,5-dienyl]cyclohexene.
| Compound Name | 4-ethenylidene-1-[(3E,5Z)-5-methylocta-3,5-dienyl]cyclohexene |
|---|---|
| PubChem CID | 163775080 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 4-ethenylidene-1-[(3E,5Z)-5-methylocta-3,5-dienyl]cyclohexene |
| SMILES | C=C=C1CC=C(CC/C=C/C(C)=C\CC)CC1 |
| InChI | InChI=1S/C17H24/c1-4-8-15(3)9-6-7-10-17-13-11-16(5-2)12-14-17/h6,8-9,13H,2,4,7,10-12,14H2,1,3H3/b9-6+,15-8- |
| InChIKey | MJSPAJZNUHMTIS-BUEOZKIHSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|