About 3-methylhexa-1,3-dien-1-ol
3-methylhexa-1,3-dien-1-ol (PubChem CID 154284508) has the molecular formula C7H12O
and a molecular weight of 112.17 g/mol. Its IUPAC name is 3-methylhexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 3-methylhexa-1,3-dien-1-ol |
| PubChem CID | 154284508 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 3-methylhexa-1,3-dien-1-ol |
| SMILES | CCC=C(C)C=CO |
| InChI | InChI=1S/C7H12O/c1-3-4-7(2)5-6-8/h4-6,8H,3H2,1-2H3 |
| InChIKey | JOZCPRDJEPQIHK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexa-1,3-dien-1-ol?
The IUPAC name of 3-methylhexa-1,3-dien-1-ol (CID 154284508) is 3-methylhexa-1,3-dien-1-ol.
What is the SMILES notation for 3-methylhexa-1,3-dien-1-ol?
The canonical SMILES for 3-methylhexa-1,3-dien-1-ol is CCC=C(C)C=CO.
What is the InChIKey of 3-methylhexa-1,3-dien-1-ol?
The InChIKey is JOZCPRDJEPQIHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O/c1-3-4-7(2)5-6-8/h4-6,8H,3H2,1-2H3.
What are the key properties of 3-methylhexa-1,3-dien-1-ol?
3-methylhexa-1,3-dien-1-ol has a molecular weight of 112.17 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexa-1,3-dien-1-ol is sourced from PubChem (CID 154284508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).