C10H17N — CID 166102143
(3Z,5Z)-N,5-dimethylocta-1,3,5-trien-2-amine (PubChem CID 166102143) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (3Z,5Z)-N,5-dimethylocta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-N,5-dimethylocta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 166102143 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3Z,5Z)-N,5-dimethylocta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(C)=C/CC)NC |
| InChI | InChI=1S/C10H17N/c1-5-6-9(2)7-8-10(3)11-4/h6-8,11H,3,5H2,1-2,4H3/b8-7-,9-6- |
| InChIKey | ALGDMZITBUDGGU-QOCNPQIPSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|