C12H21NO2 — CID 155183684
(3Z,5E)-5-ethyl-N,6-dimethyl-7-methylperoxyhepta-1,3,5-trien-2-amine (PubChem CID 155183684) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (3Z,5E)-5-ethyl-N,6-dimethyl-7-methylperoxyhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-ethyl-N,6-dimethyl-7-methylperoxyhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 155183684 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (3Z,5E)-5-ethyl-N,6-dimethyl-7-methylperoxyhepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(CC)=C(/C)COOC)NC |
| InChI | InChI=1S/C12H21NO2/c1-6-12(8-7-11(3)13-4)10(2)9-15-14-5/h7-8,13H,3,6,9H2,1-2,4-5H3/b8-7-,12-10+ |
| InChIKey | LLRHXOIHLNTBTR-QOUMFGDESA-N |
| XLogP | 2.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|