C6H12N2 — CID 143231030
(3Z)-5-imino-N-methylpenta-1,3-dien-2-amine;molecular hydrogen (PubChem CID 143231030) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (3Z)-5-imino-N-methylpenta-1,3-dien-2-amine;molecular hydrogen.
| Compound Name | (3Z)-5-imino-N-methylpenta-1,3-dien-2-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143231030 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (3Z)-5-imino-N-methylpenta-1,3-dien-2-amine;molecular hydrogen |
| SMILES | [H]/N=C/C=C\C(=C)NC.[H][H] |
| InChI | InChI=1S/C6H10N2.H2/c1-6(8-2)4-3-5-7;/h3-5,7-8H,1H2,2H3;1H/b4-3-,7-5+; |
| InChIKey | GWHKSXOSRIZUHB-LMMDHOJISA-N |
| XLogP | 1.17 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|