C11H19N — CID 167090365
(2Z,4Z)-6-methyl-4-propan-2-ylhepta-2,4-dien-1-imine (PubChem CID 167090365) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2Z,4Z)-6-methyl-4-propan-2-ylhepta-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-6-methyl-4-propan-2-ylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 167090365 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2Z,4Z)-6-methyl-4-propan-2-ylhepta-2,4-dien-1-imine |
| SMILES | [H]/N=C\C=C/C(=C\C(C)C)C(C)C |
| InChI | InChI=1S/C11H19N/c1-9(2)8-11(10(3)4)6-5-7-12/h5-10,12H,1-4H3/b6-5-,11-8+,12-7- |
| InChIKey | UWXLOZNDPQEDIJ-JUBMLIQQSA-N |
| XLogP | 3.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|