About ethane;methane;(Z)-4-methylhex-2-en-1-imine
ethane;methane;(Z)-4-methylhex-2-en-1-imine (PubChem CID 178018442) has the molecular formula C12H29N
and a molecular weight of 187.37 g/mol. Its IUPAC name is ethane;methane;(Z)-4-methylhex-2-en-1-imine.
Molecular Properties
| Compound Name | ethane;methane;(Z)-4-methylhex-2-en-1-imine |
| PubChem CID | 178018442 |
| Molecular Formula | C12H29N |
| Molecular Weight | 187.37 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | ethane;methane;(Z)-4-methylhex-2-en-1-imine |
| SMILES | C.CC.CC.[H]/N=C/C=C\C(C)CC |
| InChI | InChI=1S/C7H13N.2C2H6.CH4/c1-3-7(2)5-4-6-8;2*1-2;/h4-8H,3H2,1-2H3;2*1-2H3;1H4/b5-4-,8-6+;;; |
| InChIKey | DFHVZDUNAUZYJU-WTGUCDEJSA-N |
| XLogP | 4.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;(Z)-4-methylhex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;(Z)-4-methylhex-2-en-1-imine?
The IUPAC name of ethane;methane;(Z)-4-methylhex-2-en-1-imine (CID 178018442) is ethane;methane;(Z)-4-methylhex-2-en-1-imine.
What is the SMILES notation for ethane;methane;(Z)-4-methylhex-2-en-1-imine?
The canonical SMILES for ethane;methane;(Z)-4-methylhex-2-en-1-imine is C.CC.CC.[H]/N=C/C=C\C(C)CC.
What is the InChIKey of ethane;methane;(Z)-4-methylhex-2-en-1-imine?
The InChIKey is DFHVZDUNAUZYJU-WTGUCDEJSA-N. The full InChI is InChI=1S/C7H13N.2C2H6.CH4/c1-3-7(2)5-4-6-8;2*1-2;/h4-8H,3H2,1-2H3;2*1-2H3;1H4/b5-4-,8-6+;;;.
What are the key properties of ethane;methane;(Z)-4-methylhex-2-en-1-imine?
ethane;methane;(Z)-4-methylhex-2-en-1-imine has a molecular weight of 187.37 g/mol, XLogP of 4.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;(Z)-4-methylhex-2-en-1-imine is sourced from PubChem (CID 178018442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).